C21H29N5O5 — CID 12015843
methyl (2S)-2-[[(2S)-1-[(2R,3R)-3-azido-2-hydroxy-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoate (PubChem CID 12015843) has the molecular formula C21H29N5O5 and a molecular weight of 431.49 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-1-[(2R,3R)-3-azido-2-hydroxy-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(2S)-1-[(2R,3R)-3-azido-2-hydroxy-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 12015843 |
| Molecular Formula | C21H29N5O5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | methyl (2S)-2-[[(2S)-1-[(2R,3R)-3-azido-2-hydroxy-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)[C@@H]1CCCN1C(=O)[C@H](O)[C@H](N=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C21H29N5O5/c1-13(2)12-15(21(30)31-3)23-19(28)16-10-7-11-26(16)20(29)18(27)17(24-25-22)14-8-5-4-6-9-14/h4-6,8-9,13,15-18,27H,7,10-12H2,1-3H3,(H,23,28)/t15-,16-,17+,18+/m0/s1 |
| InChIKey | KKWJDMRKHAOSKI-WNRNVDISSA-N |
| XLogP | 2.09 |
| TPSA | 144.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|