C17H25NO5 — CID 122388239
methyl 3-(furan-2-yl)-3-oxo-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanoate (PubChem CID 122388239) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is methyl 3-(furan-2-yl)-3-oxo-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanoate.
| Compound Name | methyl 3-(furan-2-yl)-3-oxo-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanoate |
|---|---|
| PubChem CID | 122388239 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | methyl 3-(furan-2-yl)-3-oxo-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanoate |
| SMILES | COC(=O)C(ON1C(C)(C)CCCC1(C)C)C(=O)c1ccco1 |
| InChI | InChI=1S/C17H25NO5/c1-16(2)9-7-10-17(3,4)18(16)23-14(15(20)21-5)13(19)12-8-6-11-22-12/h6,8,11,14H,7,9-10H2,1-5H3 |
| InChIKey | UXJLLWFYXBUKNT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|