C20H31NO4 — CID 11695973
(2,2,6,6-tetramethylpiperidin-1-yl) 2-(furan-2-ylmethyl)-4-methyl-3-oxopentanoate (PubChem CID 11695973) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-1-yl) 2-(furan-2-ylmethyl)-4-methyl-3-oxopentanoate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-1-yl) 2-(furan-2-ylmethyl)-4-methyl-3-oxopentanoate |
|---|---|
| PubChem CID | 11695973 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-1-yl) 2-(furan-2-ylmethyl)-4-methyl-3-oxopentanoate |
| SMILES | CC(C)C(=O)C(Cc1ccco1)C(=O)ON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C20H31NO4/c1-14(2)17(22)16(13-15-9-7-12-24-15)18(23)25-21-19(3,4)10-8-11-20(21,5)6/h7,9,12,14,16H,8,10-11,13H2,1-6H3 |
| InChIKey | JGCLZEFYFJSLTA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|