C14H24N2O — CID 81170029
N-[2-[1-(aminomethyl)cyclobutyl]ethyl]-1-(furan-2-yl)propan-2-amine (PubChem CID 81170029) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N-[2-[1-(aminomethyl)cyclobutyl]ethyl]-1-(furan-2-yl)propan-2-amine.
| Compound Name | N-[2-[1-(aminomethyl)cyclobutyl]ethyl]-1-(furan-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 81170029 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N-[2-[1-(aminomethyl)cyclobutyl]ethyl]-1-(furan-2-yl)propan-2-amine |
| SMILES | CC(Cc1ccco1)NCCC1(CN)CCC1 |
| InChI | InChI=1S/C14H24N2O/c1-12(10-13-4-2-9-17-13)16-8-7-14(11-15)5-3-6-14/h2,4,9,12,16H,3,5-8,10-11,15H2,1H3 |
| InChIKey | VSGLQYMWYIBESZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |