C12H21NO2 — CID 63099763
N-(3-ethoxypropyl)-1-(furan-2-yl)propan-2-amine (PubChem CID 63099763) has the molecular formula C12H21NO2 and a molecular weight of 211.31 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-1-(furan-2-yl)propan-2-amine.
| Compound Name | N-(3-ethoxypropyl)-1-(furan-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 63099763 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | N-(3-ethoxypropyl)-1-(furan-2-yl)propan-2-amine |
| SMILES | CCOCCCNC(C)Cc1ccco1 |
| InChI | InChI=1S/C12H21NO2/c1-3-14-8-5-7-13-11(2)10-12-6-4-9-15-12/h4,6,9,11,13H,3,5,7-8,10H2,1-2H3 |
| InChIKey | LAIIIVIMVGIFIQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|