C13H23NO3 — CID 79547595
N-(2,2-diethoxyethyl)-1-(furan-2-yl)propan-2-amine (PubChem CID 79547595) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-1-(furan-2-yl)propan-2-amine.
| Compound Name | N-(2,2-diethoxyethyl)-1-(furan-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 79547595 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | N-(2,2-diethoxyethyl)-1-(furan-2-yl)propan-2-amine |
| SMILES | CCOC(CNC(C)Cc1ccco1)OCC |
| InChI | InChI=1S/C13H23NO3/c1-4-15-13(16-5-2)10-14-11(3)9-12-7-6-8-17-12/h6-8,11,13-14H,4-5,9-10H2,1-3H3 |
| InChIKey | IVRYTKFLJOJCCE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|