C16H26O3 — CID 116755417
1-(1-ethoxy-4,4-dimethylcyclohexyl)-2-(furan-2-yl)ethanol (PubChem CID 116755417) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-(1-ethoxy-4,4-dimethylcyclohexyl)-2-(furan-2-yl)ethanol.
| Compound Name | 1-(1-ethoxy-4,4-dimethylcyclohexyl)-2-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 116755417 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 1-(1-ethoxy-4,4-dimethylcyclohexyl)-2-(furan-2-yl)ethanol |
| SMILES | CCOC1(C(O)Cc2ccco2)CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H26O3/c1-4-19-16(9-7-15(2,3)8-10-16)14(17)12-13-6-5-11-18-13/h5-6,11,14,17H,4,7-10,12H2,1-3H3 |
| InChIKey | MBGAWUCJZYKKIO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |