C15H24O2S — CID 116756164
1-(1-ethoxycycloheptyl)-2-thiophen-2-ylethanol (PubChem CID 116756164) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is 1-(1-ethoxycycloheptyl)-2-thiophen-2-ylethanol.
| Compound Name | 1-(1-ethoxycycloheptyl)-2-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 116756164 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-(1-ethoxycycloheptyl)-2-thiophen-2-ylethanol |
| SMILES | CCOC1(C(O)Cc2cccs2)CCCCCC1 |
| InChI | InChI=1S/C15H24O2S/c1-2-17-15(9-5-3-4-6-10-15)14(16)12-13-8-7-11-18-13/h7-8,11,14,16H,2-6,9-10,12H2,1H3 |
| InChIKey | WIZDNKJAQXCYFB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |