C14H22O2S — CID 116755920
1-(1-methoxycycloheptyl)-2-thiophen-2-ylethanol (PubChem CID 116755920) has the molecular formula C14H22O2S and a molecular weight of 254.39 g/mol. Its IUPAC name is 1-(1-methoxycycloheptyl)-2-thiophen-2-ylethanol.
| Compound Name | 1-(1-methoxycycloheptyl)-2-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 116755920 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-(1-methoxycycloheptyl)-2-thiophen-2-ylethanol |
| SMILES | COC1(C(O)Cc2cccs2)CCCCCC1 |
| InChI | InChI=1S/C14H22O2S/c1-16-14(8-4-2-3-5-9-14)13(15)11-12-7-6-10-17-12/h6-7,10,13,15H,2-5,8-9,11H2,1H3 |
| InChIKey | KKCPFEQRCLGRTD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |