C12H17BrO2S — CID 104610489
2-(4-bromothiophen-2-yl)-1-(1-methoxycyclopentyl)ethanol (PubChem CID 104610489) has the molecular formula C12H17BrO2S and a molecular weight of 305.24 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-(1-methoxycyclopentyl)ethanol.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-(1-methoxycyclopentyl)ethanol |
|---|---|
| PubChem CID | 104610489 |
| Molecular Formula | C12H17BrO2S |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-(1-methoxycyclopentyl)ethanol |
| SMILES | COC1(C(O)Cc2cc(Br)cs2)CCCC1 |
| InChI | InChI=1S/C12H17BrO2S/c1-15-12(4-2-3-5-12)11(14)7-10-6-9(13)8-16-10/h6,8,11,14H,2-5,7H2,1H3 |
| InChIKey | GUKAPXKPKJMTEM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |