C14H22BrNOS — CID 79066491
2-(4-bromothiophen-2-yl)-1-[1-(dimethylamino)cyclohexyl]ethanol (PubChem CID 79066491) has the molecular formula C14H22BrNOS and a molecular weight of 332.31 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-[1-(dimethylamino)cyclohexyl]ethanol.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-[1-(dimethylamino)cyclohexyl]ethanol |
|---|---|
| PubChem CID | 79066491 |
| Molecular Formula | C14H22BrNOS |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-[1-(dimethylamino)cyclohexyl]ethanol |
| SMILES | CN(C)C1(C(O)Cc2cc(Br)cs2)CCCCC1 |
| InChI | InChI=1S/C14H22BrNOS/c1-16(2)14(6-4-3-5-7-14)13(17)9-12-8-11(15)10-18-12/h8,10,13,17H,3-7,9H2,1-2H3 |
| InChIKey | QJIVNSDLMOMAMB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |