C13H19BrO2S — CID 103452373
1-[2-(4-bromothiophen-2-yl)-1-hydroxyethyl]-4-methylcyclohexan-1-ol (PubChem CID 103452373) has the molecular formula C13H19BrO2S and a molecular weight of 319.26 g/mol. Its IUPAC name is 1-[2-(4-bromothiophen-2-yl)-1-hydroxyethyl]-4-methylcyclohexan-1-ol.
| Compound Name | 1-[2-(4-bromothiophen-2-yl)-1-hydroxyethyl]-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 103452373 |
| Molecular Formula | C13H19BrO2S |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1-[2-(4-bromothiophen-2-yl)-1-hydroxyethyl]-4-methylcyclohexan-1-ol |
| SMILES | CC1CCC(O)(C(O)Cc2cc(Br)cs2)CC1 |
| InChI | InChI=1S/C13H19BrO2S/c1-9-2-4-13(16,5-3-9)12(15)7-11-6-10(14)8-17-11/h6,8-9,12,15-16H,2-5,7H2,1H3 |
| InChIKey | ZMMSZENYTUNVPR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |