C11H15BrO2S — CID 116710510
2-(4-bromothiophen-2-yl)-1-(1-methoxycyclobutyl)ethanol (PubChem CID 116710510) has the molecular formula C11H15BrO2S and a molecular weight of 291.21 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-(1-methoxycyclobutyl)ethanol.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-(1-methoxycyclobutyl)ethanol |
|---|---|
| PubChem CID | 116710510 |
| Molecular Formula | C11H15BrO2S |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-(1-methoxycyclobutyl)ethanol |
| SMILES | COC1(C(O)Cc2cc(Br)cs2)CCC1 |
| InChI | InChI=1S/C11H15BrO2S/c1-14-11(3-2-4-11)10(13)6-9-5-8(12)7-15-9/h5,7,10,13H,2-4,6H2,1H3 |
| InChIKey | WUFWCHMBGJJKQY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |