C13H20O2S — CID 116753410
1-(1-methoxycyclohexyl)-2-thiophen-2-ylethanol (PubChem CID 116753410) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is 1-(1-methoxycyclohexyl)-2-thiophen-2-ylethanol.
| Compound Name | 1-(1-methoxycyclohexyl)-2-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 116753410 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1-(1-methoxycyclohexyl)-2-thiophen-2-ylethanol |
| SMILES | COC1(C(O)Cc2cccs2)CCCCC1 |
| InChI | InChI=1S/C13H20O2S/c1-15-13(7-3-2-4-8-13)12(14)10-11-6-5-9-16-11/h5-6,9,12,14H,2-4,7-8,10H2,1H3 |
| InChIKey | PWUPAGTXFBQGFB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |