C11H17NO2S — CID 104610440
1-(1-methoxycyclopentyl)-2-(1,3-thiazol-2-yl)ethanol (PubChem CID 104610440) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-(1-methoxycyclopentyl)-2-(1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(1-methoxycyclopentyl)-2-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 104610440 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 1-(1-methoxycyclopentyl)-2-(1,3-thiazol-2-yl)ethanol |
| SMILES | COC1(C(O)Cc2nccs2)CCCC1 |
| InChI | InChI=1S/C11H17NO2S/c1-14-11(4-2-3-5-11)9(13)8-10-12-6-7-15-10/h6-7,9,13H,2-5,8H2,1H3 |
| InChIKey | SIZHGAVMYQKEPW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |