C11H13BrO2S — CID 116706997
2-(4-bromothiophen-2-yl)-1-(1-methoxycyclobutyl)ethanone (PubChem CID 116706997) has the molecular formula C11H13BrO2S and a molecular weight of 289.19 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-(1-methoxycyclobutyl)ethanone.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-(1-methoxycyclobutyl)ethanone |
|---|---|
| PubChem CID | 116706997 |
| Molecular Formula | C11H13BrO2S |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-(1-methoxycyclobutyl)ethanone |
| SMILES | COC1(C(=O)Cc2cc(Br)cs2)CCC1 |
| InChI | InChI=1S/C11H13BrO2S/c1-14-11(3-2-4-11)10(13)6-9-5-8(12)7-15-9/h5,7H,2-4,6H2,1H3 |
| InChIKey | LBXHGAAZSNQHIH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |