C15H22BrNOS — CID 79074745
2-(4-bromothiophen-2-yl)-1-[1-(dimethylamino)-3-methylcyclohexyl]ethanone (PubChem CID 79074745) has the molecular formula C15H22BrNOS and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-[1-(dimethylamino)-3-methylcyclohexyl]ethanone.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-[1-(dimethylamino)-3-methylcyclohexyl]ethanone |
|---|---|
| PubChem CID | 79074745 |
| Molecular Formula | C15H22BrNOS |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-[1-(dimethylamino)-3-methylcyclohexyl]ethanone |
| SMILES | CC1CCCC(C(=O)Cc2cc(Br)cs2)(N(C)C)C1 |
| InChI | InChI=1S/C15H22BrNOS/c1-11-5-4-6-15(9-11,17(2)3)14(18)8-13-7-12(16)10-19-13/h7,10-11H,4-6,8-9H2,1-3H3 |
| InChIKey | CQRREVLJRWNRCK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |