C12H18O2 — CID 115830206
2-(furan-2-yl)-1-(1-methylcyclopentyl)ethanol (PubChem CID 115830206) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-(1-methylcyclopentyl)ethanol.
| Compound Name | 2-(furan-2-yl)-1-(1-methylcyclopentyl)ethanol |
|---|---|
| PubChem CID | 115830206 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-(furan-2-yl)-1-(1-methylcyclopentyl)ethanol |
| SMILES | CC1(C(O)Cc2ccco2)CCCC1 |
| InChI | InChI=1S/C12H18O2/c1-12(6-2-3-7-12)11(13)9-10-5-4-8-14-10/h4-5,8,11,13H,2-3,6-7,9H2,1H3 |
| InChIKey | MHQBXELHKIDLEC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |