C24H31NO4 — CID 102433425
2-(3-methoxyphenoxy)-1-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethanone (PubChem CID 102433425) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-(3-methoxyphenoxy)-1-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethanone.
| Compound Name | 2-(3-methoxyphenoxy)-1-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethanone |
|---|---|
| PubChem CID | 102433425 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 2-(3-methoxyphenoxy)-1-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethanone |
| SMILES | COc1cccc(OC(ON2C(C)(C)CCCC2(C)C)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H31NO4/c1-23(2)15-10-16-24(3,4)25(23)29-22(21(26)18-11-7-6-8-12-18)28-20-14-9-13-19(17-20)27-5/h6-9,11-14,17,22H,10,15-16H2,1-5H3 |
| InChIKey | NAFTVDLBMJSPDH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|