C20H30N2O3 — CID 122388240
N-ethyl-3-oxo-3-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanamide (PubChem CID 122388240) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-ethyl-3-oxo-3-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanamide.
| Compound Name | N-ethyl-3-oxo-3-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanamide |
|---|---|
| PubChem CID | 122388240 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | N-ethyl-3-oxo-3-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanamide |
| SMILES | CCNC(=O)C(ON1C(C)(C)CCCC1(C)C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H30N2O3/c1-6-21-18(24)17(16(23)15-11-8-7-9-12-15)25-22-19(2,3)13-10-14-20(22,4)5/h7-9,11-12,17H,6,10,13-14H2,1-5H3,(H,21,24) |
| InChIKey | IAHNYXQIJWMUSH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|