C14H17NO4 — CID 43151448
1-[(3-methoxybenzoyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 43151448) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 1-[(3-methoxybenzoyl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[(3-methoxybenzoyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 43151448 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1-[(3-methoxybenzoyl)amino]cyclopentane-1-carboxylic acid |
| SMILES | COc1cccc(C(=O)NC2(C(=O)O)CCCC2)c1 |
| InChI | InChI=1S/C14H17NO4/c1-19-11-6-4-5-10(9-11)12(16)15-14(13(17)18)7-2-3-8-14/h4-6,9H,2-3,7-8H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | YANULQKLYKBGBG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |