1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid

C15H19NO5 — CID 43351073

IUPAC1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid
SMILESCOc1ccc(OC)c(C(=O)NC2(C(=O)O)CCCC2)c1
InChIInChI=1S/C15H19NO5/c1-20-10-5-6-12(21-2)11(9-10)13(17)16-15(14(18)19)7-3-4-8-15/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,17)(H,18,19)
InChIKeyDBRGADOMOOHFHK-UHFFFAOYSA-N
MW293.32 g/mol
LogP1.83
Rot. Bonds5

About 1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid

1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 43351073) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid
PubChem CID43351073
Molecular FormulaC15H19NO5
Molecular Weight293.32 g/mol
Exact Mass293.13
IUPAC Name1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid
SMILESCOc1ccc(OC)c(C(=O)NC2(C(=O)O)CCCC2)c1
InChIInChI=1S/C15H19NO5/c1-20-10-5-6-12(21-2)11(9-10)13(17)16-15(14(18)19)7-3-4-8-15/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,17)(H,18,19)
InChIKeyDBRGADOMOOHFHK-UHFFFAOYSA-N
XLogP1.83
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.32
LogP ≤ 51.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid?
The IUPAC name of 1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid (CID 43351073) is 1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid?
The canonical SMILES for 1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid is COc1ccc(OC)c(C(=O)NC2(C(=O)O)CCCC2)c1.
What is the InChIKey of 1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid?
The InChIKey is DBRGADOMOOHFHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO5/c1-20-10-5-6-12(21-2)11(9-10)13(17)16-15(14(18)19)7-3-4-8-15/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,17)(H,18,19).
What are the key properties of 1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid?
1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid has a molecular weight of 293.32 g/mol, XLogP of 1.83, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,5-dimethoxybenzoyl)amino]cyclopentane-1-carboxylic acid is sourced from PubChem (CID 43351073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).