C18H31NO2 — CID 142146292
methoxymethane;2,2,6,6-tetramethyl-1-phenylmethoxypiperidine (PubChem CID 142146292) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is methoxymethane;2,2,6,6-tetramethyl-1-phenylmethoxypiperidine.
| Compound Name | methoxymethane;2,2,6,6-tetramethyl-1-phenylmethoxypiperidine |
|---|---|
| PubChem CID | 142146292 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | methoxymethane;2,2,6,6-tetramethyl-1-phenylmethoxypiperidine |
| SMILES | CC1(C)CCCC(C)(C)N1OCc1ccccc1.COC |
| InChI | InChI=1S/C16H25NO.C2H6O/c1-15(2)11-8-12-16(3,4)17(15)18-13-14-9-6-5-7-10-14;1-3-2/h5-7,9-10H,8,11-13H2,1-4H3;1-2H3 |
| InChIKey | HWBZEFQVWNHZPM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |