C25H33NO2 — CID 102127816
2,2,6,6-tetramethyl-1-[(Z)-2-phenyl-3-phenylmethoxyprop-2-enoxy]piperidine (PubChem CID 102127816) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-[(Z)-2-phenyl-3-phenylmethoxyprop-2-enoxy]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-[(Z)-2-phenyl-3-phenylmethoxyprop-2-enoxy]piperidine |
|---|---|
| PubChem CID | 102127816 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-[(Z)-2-phenyl-3-phenylmethoxyprop-2-enoxy]piperidine |
| SMILES | CC1(C)CCCC(C)(C)N1OC/C(=C\OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H33NO2/c1-24(2)16-11-17-25(3,4)26(24)28-20-23(22-14-9-6-10-15-22)19-27-18-21-12-7-5-8-13-21/h5-10,12-15,19H,11,16-18,20H2,1-4H3/b23-19+ |
| InChIKey | LNVQNUQFMZXJMG-FCDQGJHFSA-N |
| XLogP | 6.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|