C21H28BNOP — CID 137252116
CID 137252116 (PubChem CID 137252116) has the molecular formula C21H28BNOP and a molecular weight of 352.25 g/mol.
| Compound Name | CID 137252116 |
|---|---|
| PubChem CID | 137252116 |
| Molecular Formula | C21H28BNOP |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | — |
| SMILES | [B-][P+](ON1C(C)(C)CCCC1(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28BNOP/c1-20(2)16-11-17-21(3,4)23(20)24-25(22,18-12-7-5-8-13-18)19-14-9-6-10-15-19/h5-10,12-15H,11,16-17H2,1-4H3 |
| InChIKey | FZZGWKPNFZOTJU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|