C19H31N2OPS — CID 15142970
(3aR,7aR)-1,3-dimethyl-2-[(1R)-1-phenylpentoxy]-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole (PubChem CID 15142970) has the molecular formula C19H31N2OPS and a molecular weight of 366.51 g/mol. Its IUPAC name is (3aR,7aR)-1,3-dimethyl-2-[(1R)-1-phenylpentoxy]-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole.
| Compound Name | (3aR,7aR)-1,3-dimethyl-2-[(1R)-1-phenylpentoxy]-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole |
|---|---|
| PubChem CID | 15142970 |
| Molecular Formula | C19H31N2OPS |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (3aR,7aR)-1,3-dimethyl-2-[(1R)-1-phenylpentoxy]-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphole |
| SMILES | CCCC[C@@H](OP1(=S)N(C)[C@@H]2CCCC[C@H]2N1C)c1ccccc1 |
| InChI | InChI=1S/C19H31N2OPS/c1-4-5-15-19(16-11-7-6-8-12-16)22-23(24)20(2)17-13-9-10-14-18(17)21(23)3/h6-8,11-12,17-19H,4-5,9-10,13-15H2,1-3H3/t17-,18-,19-/m1/s1 |
| InChIKey | HENSEIZURSEFSK-GUDVDZBRSA-N |
| XLogP | 5.35 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|