C25H28ClN2OPS — CID 23421718
(4R,5R)-2-[(1S)-3-chloro-1-phenylpropoxy]-1,3-dimethyl-4,5-diphenyl-2-sulfanylidene-1,3,2λ5-diazaphospholidine (PubChem CID 23421718) has the molecular formula C25H28ClN2OPS and a molecular weight of 471.01 g/mol. Its IUPAC name is (4R,5R)-2-[(1S)-3-chloro-1-phenylpropoxy]-1,3-dimethyl-4,5-diphenyl-2-sulfanylidene-1,3,2λ5-diazaphospholidine.
| Compound Name | (4R,5R)-2-[(1S)-3-chloro-1-phenylpropoxy]-1,3-dimethyl-4,5-diphenyl-2-sulfanylidene-1,3,2λ5-diazaphospholidine |
|---|---|
| PubChem CID | 23421718 |
| Molecular Formula | C25H28ClN2OPS |
| Molecular Weight | 471.01 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | (4R,5R)-2-[(1S)-3-chloro-1-phenylpropoxy]-1,3-dimethyl-4,5-diphenyl-2-sulfanylidene-1,3,2λ5-diazaphospholidine |
| SMILES | CN1[C@H](c2ccccc2)[C@@H](c2ccccc2)N(C)P1(=S)O[C@@H](CCCl)c1ccccc1 |
| InChI | InChI=1S/C25H28ClN2OPS/c1-27-24(21-14-8-4-9-15-21)25(22-16-10-5-11-17-22)28(2)30(27,31)29-23(18-19-26)20-12-6-3-7-13-20/h3-17,23-25H,18-19H2,1-2H3/t23-,24+,25+/m0/s1 |
| InChIKey | WZBWNAUOFNHDMX-ISJGIBHGSA-N |
| XLogP | 6.96 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.01 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|