C22H41N2OPSSi2 — CID 23421748
[(3aR,7aR)-2-[(1S)-1-phenylethoxy]-2-sulfanylidene-3-(trimethylsilylmethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-1-yl]methyl-trimethylsilane (PubChem CID 23421748) has the molecular formula C22H41N2OPSSi2 and a molecular weight of 468.80 g/mol. Its IUPAC name is [(3aR,7aR)-2-[(1S)-1-phenylethoxy]-2-sulfanylidene-3-(trimethylsilylmethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-1-yl]methyl-trimethylsilane.
| Compound Name | [(3aR,7aR)-2-[(1S)-1-phenylethoxy]-2-sulfanylidene-3-(trimethylsilylmethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-1-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 23421748 |
| Molecular Formula | C22H41N2OPSSi2 |
| Molecular Weight | 468.80 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | [(3aR,7aR)-2-[(1S)-1-phenylethoxy]-2-sulfanylidene-3-(trimethylsilylmethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-1-yl]methyl-trimethylsilane |
| SMILES | C[C@H](OP1(=S)N(C[Si](C)(C)C)[C@@H]2CCCC[C@H]2N1C[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H41N2OPSSi2/c1-19(20-13-9-8-10-14-20)25-26(27)23(17-28(2,3)4)21-15-11-12-16-22(21)24(26)18-29(5,6)7/h8-10,13-14,19,21-22H,11-12,15-18H2,1-7H3/t19-,21+,22+/m0/s1 |
| InChIKey | DDXQHOMWAIUNKV-KSEOMHKRSA-N |
| XLogP | 6.67 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.80 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|