C14H22ClNO — CID 24842687
(1R)-2-[(2R)-1-methylpiperidin-2-yl]-1-phenylethanol;hydrochloride (PubChem CID 24842687) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is (1R)-2-[(2R)-1-methylpiperidin-2-yl]-1-phenylethanol;hydrochloride.
| Compound Name | (1R)-2-[(2R)-1-methylpiperidin-2-yl]-1-phenylethanol;hydrochloride |
|---|---|
| PubChem CID | 24842687 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | (1R)-2-[(2R)-1-methylpiperidin-2-yl]-1-phenylethanol;hydrochloride |
| SMILES | CN1CCCC[C@@H]1C[C@@H](O)c1ccccc1.Cl |
| InChI | InChI=1S/C14H21NO.ClH/c1-15-10-6-5-9-13(15)11-14(16)12-7-3-2-4-8-12;/h2-4,7-8,13-14,16H,5-6,9-11H2,1H3;1H/t13-,14-;/m1./s1 |
| InChIKey | YWCHUBUQYDWPKA-DTPOWOMPSA-N |
| XLogP | 3.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |