C20H29N — CID 146188955
1-methyl-2-[(3E,5Z)-3-methyl-2-phenylhepta-3,5-dienyl]piperidine (PubChem CID 146188955) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is 1-methyl-2-[(3E,5Z)-3-methyl-2-phenylhepta-3,5-dienyl]piperidine.
| Compound Name | 1-methyl-2-[(3E,5Z)-3-methyl-2-phenylhepta-3,5-dienyl]piperidine |
|---|---|
| PubChem CID | 146188955 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 1-methyl-2-[(3E,5Z)-3-methyl-2-phenylhepta-3,5-dienyl]piperidine |
| SMILES | C/C=C\C=C(/C)C(CC1CCCCN1C)c1ccccc1 |
| InChI | InChI=1S/C20H29N/c1-4-5-11-17(2)20(18-12-7-6-8-13-18)16-19-14-9-10-15-21(19)3/h4-8,11-13,19-20H,9-10,14-16H2,1-3H3/b5-4-,17-11+ |
| InChIKey | DXKCZIPHNYDUFV-AKMVBMTPSA-N |
| XLogP | 5.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|