C22H27NO3 — CID 54137242
[4-[2-(1-methylpiperidin-2-yl)-1-phenylethoxy]phenyl] acetate (PubChem CID 54137242) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is [4-[2-(1-methylpiperidin-2-yl)-1-phenylethoxy]phenyl] acetate.
| Compound Name | [4-[2-(1-methylpiperidin-2-yl)-1-phenylethoxy]phenyl] acetate |
|---|---|
| PubChem CID | 54137242 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | [4-[2-(1-methylpiperidin-2-yl)-1-phenylethoxy]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(OC(CC2CCCCN2C)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H27NO3/c1-17(24)25-20-11-13-21(14-12-20)26-22(18-8-4-3-5-9-18)16-19-10-6-7-15-23(19)2/h3-5,8-9,11-14,19,22H,6-7,10,15-16H2,1-2H3 |
| InChIKey | NYOZQRCODWAGFO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|