C16H23NO3 — CID 90475439
[(1S)-1-(3-methoxyphenyl)-2-[(2R)-1-methylpyrrolidin-2-yl]ethyl] acetate (PubChem CID 90475439) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is [(1S)-1-(3-methoxyphenyl)-2-[(2R)-1-methylpyrrolidin-2-yl]ethyl] acetate.
| Compound Name | [(1S)-1-(3-methoxyphenyl)-2-[(2R)-1-methylpyrrolidin-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 90475439 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | [(1S)-1-(3-methoxyphenyl)-2-[(2R)-1-methylpyrrolidin-2-yl]ethyl] acetate |
| SMILES | COc1cccc([C@H](C[C@H]2CCCN2C)OC(C)=O)c1 |
| InChI | InChI=1S/C16H23NO3/c1-12(18)20-16(11-14-7-5-9-17(14)2)13-6-4-8-15(10-13)19-3/h4,6,8,10,14,16H,5,7,9,11H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | KBSXWGAHGUUBFZ-ZBFHGGJFSA-N |
| XLogP | 2.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |