C22H30BrNO — CID 157458003
4-ethyl-2-[2-(1-methylpiperidin-2-yl)-1-phenylethyl]phenol;hydron;bromide (PubChem CID 157458003) has the molecular formula C22H30BrNO and a molecular weight of 404.39 g/mol. Its IUPAC name is 4-ethyl-2-[2-(1-methylpiperidin-2-yl)-1-phenylethyl]phenol;hydron;bromide.
| Compound Name | 4-ethyl-2-[2-(1-methylpiperidin-2-yl)-1-phenylethyl]phenol;hydron;bromide |
|---|---|
| PubChem CID | 157458003 |
| Molecular Formula | C22H30BrNO |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 4-ethyl-2-[2-(1-methylpiperidin-2-yl)-1-phenylethyl]phenol;hydron;bromide |
| SMILES | CCc1ccc(O)c(C(CC2CCCCN2C)c2ccccc2)c1.[Br-].[H+] |
| InChI | InChI=1S/C22H29NO.BrH/c1-3-17-12-13-22(24)21(15-17)20(18-9-5-4-6-10-18)16-19-11-7-8-14-23(19)2;/h4-6,9-10,12-13,15,19-20,24H,3,7-8,11,14,16H2,1-2H3;1H |
| InChIKey | AUCZZOBIXOKUMZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |