C20H25NO — CID 70540871
2-(1-methyl-6-phenylpiperidin-2-yl)-1-phenylethanol (PubChem CID 70540871) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-(1-methyl-6-phenylpiperidin-2-yl)-1-phenylethanol.
| Compound Name | 2-(1-methyl-6-phenylpiperidin-2-yl)-1-phenylethanol |
|---|---|
| PubChem CID | 70540871 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-(1-methyl-6-phenylpiperidin-2-yl)-1-phenylethanol |
| SMILES | CN1C(CC(O)c2ccccc2)CCCC1c1ccccc1 |
| InChI | InChI=1S/C20H25NO/c1-21-18(15-20(22)17-11-6-3-7-12-17)13-8-14-19(21)16-9-4-2-5-10-16/h2-7,9-12,18-20,22H,8,13-15H2,1H3 |
| InChIKey | QGBOSTQIYUWYED-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |