C22H27ClNO2- — CID 71296873
2-[6-(2-hydroxy-2-phenylethyl)-1-methylpiperidin-2-yl]-1-phenylethanone chloride (PubChem CID 71296873) has the molecular formula C22H27ClNO2- and a molecular weight of 372.92 g/mol. Its IUPAC name is 2-[6-(2-hydroxy-2-phenylethyl)-1-methylpiperidin-2-yl]-1-phenylethanone chloride.
| Compound Name | 2-[6-(2-hydroxy-2-phenylethyl)-1-methylpiperidin-2-yl]-1-phenylethanone chloride |
|---|---|
| PubChem CID | 71296873 |
| Molecular Formula | C22H27ClNO2- |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[6-(2-hydroxy-2-phenylethyl)-1-methylpiperidin-2-yl]-1-phenylethanone chloride |
| SMILES | CN1C(CC(=O)c2ccccc2)CCCC1CC(O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H27NO2.ClH/c1-23-19(15-21(24)17-9-4-2-5-10-17)13-8-14-20(23)16-22(25)18-11-6-3-7-12-18;/h2-7,9-12,19-21,24H,8,13-16H2,1H3;1H/p-1 |
| InChIKey | MKMYPTLXLWOUSO-UHFFFAOYSA-M |
| XLogP | 1.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |