C45H50Cl2N2O3 — CID 174409321
2,4-bis(4-chlorophenyl)-1,5-bis(1-methyl-6-phenacylpiperidin-2-yl)pentan-3-one (PubChem CID 174409321) has the molecular formula C45H50Cl2N2O3 and a molecular weight of 737.81 g/mol. Its IUPAC name is 2,4-bis(4-chlorophenyl)-1,5-bis(1-methyl-6-phenacylpiperidin-2-yl)pentan-3-one.
| Compound Name | 2,4-bis(4-chlorophenyl)-1,5-bis(1-methyl-6-phenacylpiperidin-2-yl)pentan-3-one |
|---|---|
| PubChem CID | 174409321 |
| Molecular Formula | C45H50Cl2N2O3 |
| Molecular Weight | 737.81 g/mol |
| Exact Mass | 736.32 |
| IUPAC Name | 2,4-bis(4-chlorophenyl)-1,5-bis(1-methyl-6-phenacylpiperidin-2-yl)pentan-3-one |
| SMILES | CN1C(CC(=O)c2ccccc2)CCCC1CC(C(=O)C(CC1CCCC(CC(=O)c2ccccc2)N1C)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C45H50Cl2N2O3/c1-48-37(15-9-17-39(48)29-43(50)33-11-5-3-6-12-33)27-41(31-19-23-35(46)24-20-31)45(52)42(32-21-25-36(47)26-22-32)28-38-16-10-18-40(49(38)2)30-44(51)34-13-7-4-8-14-34/h3-8,11-14,19-26,37-42H,9-10,15-18,27-30H2,1-2H3 |
| InChIKey | OAZPWWJYXOLGKX-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.81 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |