C22H27NO4 — CID 162817773
2-[6-[2-(2,3-dihydroxyphenyl)-2-hydroxyethyl]-1-methylpiperidin-2-yl]-1-phenylethanone (PubChem CID 162817773) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-[6-[2-(2,3-dihydroxyphenyl)-2-hydroxyethyl]-1-methylpiperidin-2-yl]-1-phenylethanone.
| Compound Name | 2-[6-[2-(2,3-dihydroxyphenyl)-2-hydroxyethyl]-1-methylpiperidin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 162817773 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-[6-[2-(2,3-dihydroxyphenyl)-2-hydroxyethyl]-1-methylpiperidin-2-yl]-1-phenylethanone |
| SMILES | CN1C(CC(=O)c2ccccc2)CCCC1CC(O)c1cccc(O)c1O |
| InChI | InChI=1S/C22H27NO4/c1-23-16(13-20(25)15-7-3-2-4-8-15)9-5-10-17(23)14-21(26)18-11-6-12-19(24)22(18)27/h2-4,6-8,11-12,16-17,21,24,26-27H,5,9-10,13-14H2,1H3 |
| InChIKey | UUCZXFFJDVBFML-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|