C21H32O2Si — CID 102124168
[(Z,2R,5S)-5-cyclohexyl-5-[dimethyl(phenyl)silyl]pent-3-en-2-yl] acetate (PubChem CID 102124168) has the molecular formula C21H32O2Si and a molecular weight of 344.57 g/mol. Its IUPAC name is [(Z,2R,5S)-5-cyclohexyl-5-[dimethyl(phenyl)silyl]pent-3-en-2-yl] acetate.
| Compound Name | [(Z,2R,5S)-5-cyclohexyl-5-[dimethyl(phenyl)silyl]pent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 102124168 |
| Molecular Formula | C21H32O2Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | [(Z,2R,5S)-5-cyclohexyl-5-[dimethyl(phenyl)silyl]pent-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@H](C)/C=C\[C@H](C1CCCCC1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H32O2Si/c1-17(23-18(2)22)15-16-21(19-11-7-5-8-12-19)24(3,4)20-13-9-6-10-14-20/h6,9-10,13-17,19,21H,5,7-8,11-12H2,1-4H3/b16-15-/t17-,21-/m1/s1 |
| InChIKey | VRRXPNAXADNARR-ARXXYZNRSA-N |
| XLogP | 5.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|