C23H37NO3Si — CID 102466426
[(3R,4S)-4-[benzyl(trimethylsilyloxy)amino]-5-cyclohexylpent-1-en-3-yl] acetate (PubChem CID 102466426) has the molecular formula C23H37NO3Si and a molecular weight of 403.64 g/mol. Its IUPAC name is [(3R,4S)-4-[benzyl(trimethylsilyloxy)amino]-5-cyclohexylpent-1-en-3-yl] acetate.
| Compound Name | [(3R,4S)-4-[benzyl(trimethylsilyloxy)amino]-5-cyclohexylpent-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 102466426 |
| Molecular Formula | C23H37NO3Si |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | [(3R,4S)-4-[benzyl(trimethylsilyloxy)amino]-5-cyclohexylpent-1-en-3-yl] acetate |
| SMILES | C=C[C@@H](OC(C)=O)[C@H](CC1CCCCC1)N(Cc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C23H37NO3Si/c1-6-23(26-19(2)25)22(17-20-13-9-7-10-14-20)24(27-28(3,4)5)18-21-15-11-8-12-16-21/h6,8,11-12,15-16,20,22-23H,1,7,9-10,13-14,17-18H2,2-5H3/t22-,23+/m0/s1 |
| InChIKey | HTLUDMQQOBVKIM-XZOQPEGZSA-N |
| XLogP | 5.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|