C28H39NO — CID 10894772
(2S)-1-cyclohexyl-2-(dibenzylamino)-6-methylheptan-3-one (PubChem CID 10894772) has the molecular formula C28H39NO and a molecular weight of 405.63 g/mol. Its IUPAC name is (2S)-1-cyclohexyl-2-(dibenzylamino)-6-methylheptan-3-one.
| Compound Name | (2S)-1-cyclohexyl-2-(dibenzylamino)-6-methylheptan-3-one |
|---|---|
| PubChem CID | 10894772 |
| Molecular Formula | C28H39NO |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | (2S)-1-cyclohexyl-2-(dibenzylamino)-6-methylheptan-3-one |
| SMILES | CC(C)CCC(=O)[C@H](CC1CCCCC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H39NO/c1-23(2)18-19-28(30)27(20-24-12-6-3-7-13-24)29(21-25-14-8-4-9-15-25)22-26-16-10-5-11-17-26/h4-5,8-11,14-17,23-24,27H,3,6-7,12-13,18-22H2,1-2H3/t27-/m0/s1 |
| InChIKey | JEXFBOFSAYJRMJ-MHZLTWQESA-N |
| XLogP | 7.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |