C23H31NO — CID 11099804
(2R)-1-(dibenzylamino)-2,6-dimethylheptan-3-one (PubChem CID 11099804) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is (2R)-1-(dibenzylamino)-2,6-dimethylheptan-3-one.
| Compound Name | (2R)-1-(dibenzylamino)-2,6-dimethylheptan-3-one |
|---|---|
| PubChem CID | 11099804 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (2R)-1-(dibenzylamino)-2,6-dimethylheptan-3-one |
| SMILES | CC(C)CCC(=O)[C@H](C)CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H31NO/c1-19(2)14-15-23(25)20(3)16-24(17-21-10-6-4-7-11-21)18-22-12-8-5-9-13-22/h4-13,19-20H,14-18H2,1-3H3/t20-/m1/s1 |
| InChIKey | DKKRLPIIDOSWSY-HXUWFJFHSA-N |
| XLogP | 5.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |