C25H31NO2 — CID 134928562
(2S)-1-(3-cyclohexyloxiran-2-yl)-2-(dibenzylamino)propan-1-one (PubChem CID 134928562) has the molecular formula C25H31NO2 and a molecular weight of 377.53 g/mol. Its IUPAC name is (2S)-1-(3-cyclohexyloxiran-2-yl)-2-(dibenzylamino)propan-1-one.
| Compound Name | (2S)-1-(3-cyclohexyloxiran-2-yl)-2-(dibenzylamino)propan-1-one |
|---|---|
| PubChem CID | 134928562 |
| Molecular Formula | C25H31NO2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | (2S)-1-(3-cyclohexyloxiran-2-yl)-2-(dibenzylamino)propan-1-one |
| SMILES | C[C@@H](C(=O)C1OC1C1CCCCC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H31NO2/c1-19(23(27)25-24(28-25)22-15-9-4-10-16-22)26(17-20-11-5-2-6-12-20)18-21-13-7-3-8-14-21/h2-3,5-8,11-14,19,22,24-25H,4,9-10,15-18H2,1H3/t19-,24?,25?/m0/s1 |
| InChIKey | KHGYSJYQWAHWRW-CCYWVKEMSA-N |
| XLogP | 4.99 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|