C25H25NO2 — CID 10595423
(2S)-2-(dibenzylamino)-1-[(2S,3R)-3-phenyloxiran-2-yl]propan-1-one (PubChem CID 10595423) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is (2S)-2-(dibenzylamino)-1-[(2S,3R)-3-phenyloxiran-2-yl]propan-1-one.
| Compound Name | (2S)-2-(dibenzylamino)-1-[(2S,3R)-3-phenyloxiran-2-yl]propan-1-one |
|---|---|
| PubChem CID | 10595423 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (2S)-2-(dibenzylamino)-1-[(2S,3R)-3-phenyloxiran-2-yl]propan-1-one |
| SMILES | C[C@@H](C(=O)[C@H]1O[C@@H]1c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H25NO2/c1-19(23(27)25-24(28-25)22-15-9-4-10-16-22)26(17-20-11-5-2-6-12-20)18-21-13-7-3-8-14-21/h2-16,19,24-25H,17-18H2,1H3/t19-,24+,25+/m0/s1 |
| InChIKey | FZBMWNQRMZSCRA-QTLGCAHFSA-N |
| XLogP | 4.79 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|