C24H29NO2 — CID 101040917
2-(dibenzylamino)-1-[(2S)-1-oxaspiro[2.5]octan-2-yl]propan-1-one (PubChem CID 101040917) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-(dibenzylamino)-1-[(2S)-1-oxaspiro[2.5]octan-2-yl]propan-1-one.
| Compound Name | 2-(dibenzylamino)-1-[(2S)-1-oxaspiro[2.5]octan-2-yl]propan-1-one |
|---|---|
| PubChem CID | 101040917 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 2-(dibenzylamino)-1-[(2S)-1-oxaspiro[2.5]octan-2-yl]propan-1-one |
| SMILES | CC(C(=O)[C@H]1OC12CCCCC2)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H29NO2/c1-19(22(26)23-24(27-23)15-9-4-10-16-24)25(17-20-11-5-2-6-12-20)18-21-13-7-3-8-14-21/h2-3,5-8,11-14,19,23H,4,9-10,15-18H2,1H3/t19?,23-/m1/s1 |
| InChIKey | MBNHQTJUWSHOTK-LEQGEALCSA-N |
| XLogP | 4.75 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|