C21H30N2O2 — CID 108972199
1-N'-benzyl-1-N-cyclohexyl-1-N'-propan-2-ylcyclopropane-1,1-dicarboxamide (PubChem CID 108972199) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 1-N'-benzyl-1-N-cyclohexyl-1-N'-propan-2-ylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-benzyl-1-N-cyclohexyl-1-N'-propan-2-ylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108972199 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1-N'-benzyl-1-N-cyclohexyl-1-N'-propan-2-ylcyclopropane-1,1-dicarboxamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)C1(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C21H30N2O2/c1-16(2)23(15-17-9-5-3-6-10-17)20(25)21(13-14-21)19(24)22-18-11-7-4-8-12-18/h3,5-6,9-10,16,18H,4,7-8,11-15H2,1-2H3,(H,22,24) |
| InChIKey | RSTMYYWYNJCKQT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|