C23H35N3O2 — CID 113005494
4-N-benzyl-1-N-cyclohexyl-4-N-propan-2-ylpiperidine-1,4-dicarboxamide (PubChem CID 113005494) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 4-N-benzyl-1-N-cyclohexyl-4-N-propan-2-ylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-benzyl-1-N-cyclohexyl-4-N-propan-2-ylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 113005494 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 4-N-benzyl-1-N-cyclohexyl-4-N-propan-2-ylpiperidine-1,4-dicarboxamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)C1CCN(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C23H35N3O2/c1-18(2)26(17-19-9-5-3-6-10-19)22(27)20-13-15-25(16-14-20)23(28)24-21-11-7-4-8-12-21/h3,5-6,9-10,18,20-21H,4,7-8,11-17H2,1-2H3,(H,24,28) |
| InChIKey | QGFOGLXOIYZKPU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |