C23H26N2O3 — CID 108979606
1-N-(4-acetylphenyl)-1-N'-benzyl-1-N'-propan-2-ylcyclopropane-1,1-dicarboxamide (PubChem CID 108979606) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-N-(4-acetylphenyl)-1-N'-benzyl-1-N'-propan-2-ylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(4-acetylphenyl)-1-N'-benzyl-1-N'-propan-2-ylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108979606 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-N-(4-acetylphenyl)-1-N'-benzyl-1-N'-propan-2-ylcyclopropane-1,1-dicarboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)C2(C(=O)N(Cc3ccccc3)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H26N2O3/c1-16(2)25(15-18-7-5-4-6-8-18)22(28)23(13-14-23)21(27)24-20-11-9-19(10-12-20)17(3)26/h4-12,16H,13-15H2,1-3H3,(H,24,27) |
| InChIKey | RTUGKXYMOITMHF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|