C13H16O2 — CID 14288141
2-methyl-1-[(2R,3R)-3-phenyloxiran-2-yl]butan-1-one (PubChem CID 14288141) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-methyl-1-[(2R,3R)-3-phenyloxiran-2-yl]butan-1-one.
| Compound Name | 2-methyl-1-[(2R,3R)-3-phenyloxiran-2-yl]butan-1-one |
|---|---|
| PubChem CID | 14288141 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-methyl-1-[(2R,3R)-3-phenyloxiran-2-yl]butan-1-one |
| SMILES | CCC(C)C(=O)[C@@H]1O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H16O2/c1-3-9(2)11(14)13-12(15-13)10-7-5-4-6-8-10/h4-9,12-13H,3H2,1-2H3/t9?,12-,13+/m1/s1 |
| InChIKey | BCUAQQCHLCMWGY-MDGPAFOCSA-N |
| XLogP | 2.74 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|