C18H22O3 — CID 101414867
[(1S,4R)-4-cyclohexyl-4-hydroxy-1-phenylbut-2-ynyl] acetate (PubChem CID 101414867) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is [(1S,4R)-4-cyclohexyl-4-hydroxy-1-phenylbut-2-ynyl] acetate.
| Compound Name | [(1S,4R)-4-cyclohexyl-4-hydroxy-1-phenylbut-2-ynyl] acetate |
|---|---|
| PubChem CID | 101414867 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [(1S,4R)-4-cyclohexyl-4-hydroxy-1-phenylbut-2-ynyl] acetate |
| SMILES | CC(=O)O[C@H](C#C[C@H](O)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H22O3/c1-14(19)21-18(16-10-6-3-7-11-16)13-12-17(20)15-8-4-2-5-9-15/h3,6-7,10-11,15,17-18,20H,2,4-5,8-9H2,1H3/t17-,18+/m0/s1 |
| InChIKey | QBMGKSZRASQNJJ-ZWKOTPCHSA-N |
| XLogP | 3.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|