C15H19ClO2 — CID 11879476
[(R)-[(1R,2S)-2-chlorocyclohexyl]-phenylmethyl] acetate (PubChem CID 11879476) has the molecular formula C15H19ClO2 and a molecular weight of 266.77 g/mol. Its IUPAC name is [(R)-[(1R,2S)-2-chlorocyclohexyl]-phenylmethyl] acetate.
| Compound Name | [(R)-[(1R,2S)-2-chlorocyclohexyl]-phenylmethyl] acetate |
|---|---|
| PubChem CID | 11879476 |
| Molecular Formula | C15H19ClO2 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | [(R)-[(1R,2S)-2-chlorocyclohexyl]-phenylmethyl] acetate |
| SMILES | CC(=O)O[C@@H](c1ccccc1)[C@H]1CCCC[C@@H]1Cl |
| InChI | InChI=1S/C15H19ClO2/c1-11(17)18-15(12-7-3-2-4-8-12)13-9-5-6-10-14(13)16/h2-4,7-8,13-15H,5-6,9-10H2,1H3/t13-,14-,15-/m0/s1 |
| InChIKey | YPWUVWVUPDICLE-KKUMJFAQSA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|